|
|
|
Leap Chem Co., Ltdis a supplier of
|
 |
Propionic acid d5 |
|
|
This listing includes other chemicals and chemical products supplied by Leap Chem Co., Ltd.
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on Leap Chem Co., Ltd |
LEAPChem, a specialized fine chemicals supplier for research, development and production.
LEAPChem provides nearly 5,000 rare and innovative chemical products to support the evolving needs of our customers in research & bulk manufacturing activities.
As a highly customer-oriented enterprise, we are committed to providing high-quality customer services and products to our global customers in a cost-effective and efficient manner.
Our client list includes many major pharmaceutical and science companies, universities, research institutions and chemical catalogue companies.
Methodology: Sound and Stable;Active and Innovative.
Attitude: Conscientious; Ingenious.
Goals: Customer’s Satisfaction
We regard client’s success as our success.
At LEAPChem we strive to be the preferred supplier for efficiency increasing and cost lowering in your Research&Production.
To achieve this strategic vision, we always push ourself to exceed our customer's requirement. By focusing 'Beyond Your Expectation' we continually expand our product line, enhance our systematic management and human resources.
Welcome to contact us and we look forward to becoming your preferred partner.
|
|
Leap Chem Co., Ltd also offers: Propionic acid 6-chloro-O-tolyl ester Propionic acid 4-ethylphenyl ester Propionic acid 3-methylphenyl ester Propionic acid 3-(1-methyl-3-propyl-3-pyrrolidinyl)phenyl ester Propionic acid 3,5,6-trichloro-2,4-dicyanophenyl ester Propionic acid 2-hydroxyethyl ester Propionic acid 2-(p-nitrophenyl)hydrazide Propionic acid 2-(p-bromophenyl)hydrazide Propionic acid 2,2-dimethylpropyl ester Propionic acid 2,2,2-trichloro-1-(diethoxyphosphinyl)ethyl ester PROPIONIC ACID 13C3 Propionic acid 1-methylnonyl ester Propionic acid 1,2-dihydro-6-methyl-2-oxopyridin-4-yl ester Propionic acid 1,2,6-trimethyltetradecyl ester Propionic acid (Z)-2-hexenyl ester Propionic acid (3S)-1,3α-dimethyl-4-phenylpiperidine-4β-yl ester Propionic acid (3R)-1,3β-dimethyl-4-phenylpiperidine-4α-yl ester Propionic acid (1S2R)-2-[n-benzyl-N-(mesitylenesulfonyl)amino]-1-phenylpropyl ester Propionic acid (1R,2S)-2-[n-benzyl-N-(mesitylenesulfonyl)amino]-1-phenylpropyl ester Propionic acid Propionibacteriumfreudenreichii-culturedskimmilk Propionibacteriumfreudenreichii-cultureddextrose Propionanilide, N-(1-(morpholinocarbonyl)ethyl)- Propionamidine, n-butyl-2-chloro- Propionamidine, N,N-diethyl-N-propionyl-(3ci) Propionamidine hydrochloride Propionamidine hydrochloride Propionamide, N-[2-(4-pyridyl)ethyl]- Propionamide, N-salicylidene-(4ci) Propionamide, N-P-hydroxybenzylidene-(4ci) Propionamide, N-P-benzoquinonyl- Propionamide, N-methyl-N-(tetrahydropyran-2-yl)- Propionamide, N-m-hydroxybenzylidene-(4ci) Propionamide, N-isopentyl-N-nitroso-(5ci) Propionamide, N-(isopropylsulfonyl)-(5ci) Propionamide, N-(6-amino-1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-5-pyrimidinyl)-(5ci) Propionamide, N-(5-iodo-2-thiazolyl)-2-methyl- Propionamide, N-(5-chloro-2-thiazolyl)-2-methyl- Propionamide, N-(5-chloro-2-thiazolyl)-2,2-dimethyl- Propionamide, N-(4-oxo-2-thiazolin-2-yl)- Propionamide, N-(4-methyl-3-thienyl)-3-(propylamino)- Propionamide, N-(3,5-dimethyl-4-isoxazolyl)-2-(propylamino)- Propionamide, N-(2,5-dihydroxypentyl)-(5ci) Propionamide, N-(1,1-dimethylbutyl)-2-methyl- Propionamide, N-((N-nitrosobenzylamino)methyl)- Propionamide, alpha,-alpha-diacetamido- Propionamide, 2-methyl-2-propionamidothio- Propionamide, 2,3-diamino-N-(carbamoylmethyl)-, DL-(5ci) Propionamide Propionaldehyde-d2
|
|
|
| Propionic acid d5 is offered by other companies |
Amadis Chemical Company Limited
|
|
|
|
|
|